cas: 145485-58-1 — see every product listed under this CAS number, including other names
6-Fluoro-4,5-dihydro-1H-benzo[b]azepin-2(3H)-one, 98% (CAS 145485-58-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F337717-100MG |
| cas | 145485-58-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 581.06 Pln | |
| Fluorochem | 250mg | 857.01 Pln | |
| Fluorochem | 1g | 2080.54 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
6-fluoro-1,3,4,5-tetrahydro-1-benzazepin-2-one (CAS 145485-58-1) is a chemical compound with the molecular formula C10H10FNO and a molecular weight of 179.19 g/mol. IUPAC name: 6-fluoro-1,3,4,5-tetrahydro-1-benzazepin-2-one. InChIKey: OISQPDAXCFWYTC-UHFFFAOYSA-N.
| Molecular formula | C10H10FNO |
|---|---|
| Molecular weight | 179.19 g/mol |
| IUPAC name | 6-fluoro-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| InChIKey | OISQPDAXCFWYTC-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC=C2F)NC(=O)C1 |
Computed by PubChem (NCBI)