cas: 321309-28-8 — see every product listed under this CAS number, including other names
6-Fluoro-4H-benzo[1,3]dioxine-8-carboxylic acid (CAS 321309-28-8) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F047440-1G |
| cas | 321309-28-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 877.83 Pln |
| delivery time | 2-3 weeks |
|---|
6-fluoro-4H-1,3-benzodioxine-8-carboxylic acid (CAS 321309-28-8) is a chemical compound with the molecular formula C9H7FO4 and a molecular weight of 198.15 g/mol. IUPAC name: 6-fluoro-4H-1,3-benzodioxine-8-carboxylic acid. InChIKey: HWBALMSPYAUMMB-UHFFFAOYSA-N.
| Molecular formula | C9H7FO4 |
|---|---|
| Molecular weight | 198.15 g/mol |
| IUPAC name | 6-fluoro-4H-1,3-benzodioxine-8-carboxylic acid |
| InChIKey | HWBALMSPYAUMMB-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC(=C2)F)C(=O)O)OCO1 |
Computed by PubChem (NCBI)