Products 500779-09-9
CAS 500779-09-9 appears in our catalog under these names: 2-(Carboxymethyl)-4-fluorobenzoic acid, 98%, 2–(Carboxymethyl)–4–fluorobenzoic acid, 2-(Carboxymethyl)-4-fluorobenzoic acid 97%, 2-(Carboxymethyl)-4-fluorobenzoic acid, 96%, 96%, 2-(Carboxymethyl)-4-fluorobenzoic acid, 96%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 25g, 5g, 250mg, 100g.
2-(carboxymethyl)-4-fluorobenzoic acid (CAS 500779-09-9) is a chemical compound with the molecular formula C9H7FO4 and a molecular weight of 198.15 g/mol. IUPAC name: 2-(carboxymethyl)-4-fluorobenzoic acid. InChIKey: NJRYCMRYNLWLED-UHFFFAOYSA-N.
| Molecular formula | C9H7FO4 |
|---|---|
| Molecular weight | 198.15 g/mol |
| IUPAC name | 2-(carboxymethyl)-4-fluorobenzoic acid |
| InChIKey | NJRYCMRYNLWLED-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)CC(=O)O)C(=O)O |
Computed by PubChem (NCBI)