CAS 321309-28-8 appears in our catalog under these names: 6-Fluoro-4h-1,3-benzodioxine-8-carboxylic acid, 95%, 6-Fluoro-4H-1,3-benzodioxine-8-carboxylic acid, 97% , 6-Fluoro-4H-benzo[1,3]dioxine-8-carboxylic acid. Offered by: Combi-blocks, Thermo Scientific, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 10g.
6-fluoro-4H-1,3-benzodioxine-8-carboxylic acid (CAS 321309-28-8) is a chemical compound with the molecular formula C9H7FO4 and a molecular weight of 198.15 g/mol. IUPAC name: 6-fluoro-4H-1,3-benzodioxine-8-carboxylic acid. InChIKey: HWBALMSPYAUMMB-UHFFFAOYSA-N.
| Molecular formula | C9H7FO4 |
|---|---|
| Molecular weight | 198.15 g/mol |
| IUPAC name | 6-fluoro-4H-1,3-benzodioxine-8-carboxylic acid |
| InChIKey | HWBALMSPYAUMMB-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC(=C2)F)C(=O)O)OCO1 |
Computed by PubChem (NCBI)