cas: 1207623-96-8 — see every product listed under this CAS number, including other names
6-Fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole, 95%, 95% (CAS 1207623-96-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1107J2-100mg |
| cas | 1207623-96-8 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 736.40 Pln | |
| Chemat | 250mg | 1149.20 Pln | |
| Chemat | 1g | 2781.20 Pln | |
| Chemat | 5g | 12890.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
6-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole (CAS 1207623-96-8) is a chemical compound with the molecular formula C14H17BFNO2 and a molecular weight of 261.10 g/mol. IUPAC name: 6-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole. InChIKey: AMTWQPUJRSKZAR-UHFFFAOYSA-N.
| Molecular formula | C14H17BFNO2 |
|---|---|
| Molecular weight | 261.10 g/mol |
| IUPAC name | 6-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole |
| InChIKey | AMTWQPUJRSKZAR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2F)NC=C3 |
Computed by PubChem (NCBI)