cas: 22614-75-1 — see every product listed under this CAS number, including other names
6-Fluoroquinolin-2(1H)-one, 97% (CAS 22614-75-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F216016-1G |
| cas | 22614-75-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 320.74 Pln | |
| Fluorochem | 5g | 1174.60 Pln | |
| Fluorochem | 25g | 4605.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
6-fluoro-1H-quinolin-2-one (CAS 22614-75-1) is a chemical compound with the molecular formula C9H6FNO and a molecular weight of 163.15 g/mol. IUPAC name: 6-fluoro-1H-quinolin-2-one. InChIKey: CJVMYPHDEMEFEM-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO |
|---|---|
| Molecular weight | 163.15 g/mol |
| IUPAC name | 6-fluoro-1H-quinolin-2-one |
| InChIKey | CJVMYPHDEMEFEM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=O)N2)C=C1F |
Computed by PubChem (NCBI)