cas: 311346-64-2 — see every product listed under this CAS number, including other names
6-Fluoroquinoline, HCl, 98% (CAS 311346-64-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A101840-1g |
| cas | 311346-64-2 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 538.72 Pln | |
| AmBeed | 5g | 1931.86 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
6-fluoroquinoline;hydrochloride (CAS 311346-64-2) is a chemical compound with the molecular formula C9H7ClFN and a molecular weight of 183.61 g/mol. IUPAC name: 6-fluoroquinoline;hydrochloride. InChIKey: JTXVLKSKNXUTDD-UHFFFAOYSA-N.
| Molecular formula | C9H7ClFN |
|---|---|
| Molecular weight | 183.61 g/mol |
| IUPAC name | 6-fluoroquinoline;hydrochloride |
| InChIKey | JTXVLKSKNXUTDD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)F)N=C1.Cl |
Computed by PubChem (NCBI)