CAS 1057676-61-5 is the registry number for 3-(2-Chloro-6-fluorophenyl)propanenitrile. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-(2-chloro-6-fluorophenyl)propanenitrile (CAS 1057676-61-5) is a chemical compound with the molecular formula C9H7ClFN and a molecular weight of 183.61 g/mol. IUPAC name: 3-(2-chloro-6-fluorophenyl)propanenitrile. InChIKey: RFRIAUVPCSRKFU-UHFFFAOYSA-N.
| Molecular formula | C9H7ClFN |
|---|---|
| Molecular weight | 183.61 g/mol |
| IUPAC name | 3-(2-chloro-6-fluorophenyl)propanenitrile |
| InChIKey | RFRIAUVPCSRKFU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)CCC#N)F |
Computed by PubChem (NCBI)