Products 311346-65-3

CAS 311346-65-3 is the registry number for 8-Fluoroquinoline hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 100g, 1g.

Structural formula: {0} (CAS {1})

8-fluoroquinoline;hydrochloride (CAS 311346-65-3) is a chemical compound with the molecular formula C9H7ClFN and a molecular weight of 183.61 g/mol. IUPAC name: 8-fluoroquinoline;hydrochloride. InChIKey: OLMMLDGKOACPHX-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7ClFN
Molecular weight183.61 g/mol
IUPAC name8-fluoroquinoline;hydrochloride
InChIKeyOLMMLDGKOACPHX-UHFFFAOYSA-N
SMILESC1=CC2=C(C(=C1)F)N=CC=C2.Cl

Computed by PubChem (NCBI)