cas: 691900-59-1 — see every product listed under this CAS number, including other names
6-Methoxy-1H-indazole-3-carbonitrile, 98%, 98% (CAS 691900-59-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IBWT-100mg |
| cas | 691900-59-1 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 218.00 Pln | |
| Chemat | 1g | 606.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6-methoxy-1H-indazole-3-carbonitrile (CAS 691900-59-1) is a chemical compound with the molecular formula C9H7N3O and a molecular weight of 173.17 g/mol. IUPAC name: 6-methoxy-1H-indazole-3-carbonitrile. InChIKey: QAJXYNLOGLGDCG-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O |
|---|---|
| Molecular weight | 173.17 g/mol |
| IUPAC name | 6-methoxy-1H-indazole-3-carbonitrile |
| InChIKey | QAJXYNLOGLGDCG-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=NN2)C#N |
Computed by PubChem (NCBI)