cas: 88752-76-5 — see every product listed under this CAS number, including other names
6-Methoxy-2-methyl-quinoline-3-carboxylic acid, 98% (CAS 88752-76-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F057864-100MG |
| cas | 88752-76-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 159.34 Pln | |
| Fluorochem | 250mg | 237.43 Pln | |
| Fluorochem | 500mg | 325.94 Pln | |
| Fluorochem | 1g | 575.86 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
6-methoxy-2-methylquinoline-3-carboxylic acid (CAS 88752-76-5) is a chemical compound with the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. IUPAC name: 6-methoxy-2-methylquinoline-3-carboxylic acid. InChIKey: HQTMGNSGKYFHAM-UHFFFAOYSA-N.
| Molecular formula | C12H11NO3 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | 6-methoxy-2-methylquinoline-3-carboxylic acid |
| InChIKey | HQTMGNSGKYFHAM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C2C=C(C=CC2=N1)OC)C(=O)O |
Computed by PubChem (NCBI)