cas: 26149-11-1 — see every product listed under this CAS number, including other names
6-Methoxy-3-nitropyridin-2-ol, 98%, 98% (CAS 26149-11-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113RUS-100mg |
| cas | 26149-11-1 |
| size | 100mg |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 222.80 Pln | |
| Chemat | 10g | 376.40 Pln | |
| Chemat | 25g | 693.20 Pln | |
| Chemat | 250g | 1235.60 Pln | |
| Chemat | 500g | 2337.60 Pln | |
| Chemat | 1kg | 4456.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6-methoxy-3-nitro-1H-pyridin-2-one (CAS 26149-11-1) is a chemical compound with the molecular formula C6H6N2O4 and a molecular weight of 170.12 g/mol. IUPAC name: 6-methoxy-3-nitro-1H-pyridin-2-one. InChIKey: RYLKVLKLMVFOBM-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O4 |
|---|---|
| Molecular weight | 170.12 g/mol |
| IUPAC name | 6-methoxy-3-nitro-1H-pyridin-2-one |
| InChIKey | RYLKVLKLMVFOBM-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C(=O)N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)