cas: 1211584-76-7 — see every product listed under this CAS number, including other names
6-Methoxy-5-(trifluoromethyl)pyridin-3-amine, 97%, 97% (CAS 1211584-76-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114MDC-100mg |
| cas | 1211584-76-7 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 174.80 Pln | |
| Chemat | 1g | 506.00 Pln | |
| Chemat | 10g | 3179.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
6-methoxy-5-(trifluoromethyl)pyridin-3-amine (CAS 1211584-76-7) is a chemical compound with the molecular formula C7H7F3N2O and a molecular weight of 192.14 g/mol. IUPAC name: 6-methoxy-5-(trifluoromethyl)pyridin-3-amine. InChIKey: AHFNQSHZCUHVFS-UHFFFAOYSA-N.
| Molecular formula | C7H7F3N2O |
|---|---|
| Molecular weight | 192.14 g/mol |
| IUPAC name | 6-methoxy-5-(trifluoromethyl)pyridin-3-amine |
| InChIKey | AHFNQSHZCUHVFS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=N1)N)C(F)(F)F |
Computed by PubChem (NCBI)