cas: 5467-79-8 — see every product listed under this CAS number, including other names
6-Methoxyquinoline-2-carbonitrile, 97%, 97% (CAS 5467-79-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DEMM-250mg |
| cas | 5467-79-8 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 266.00 Pln | |
| Chemat | 1g | 630.80 Pln | |
| Chemat | 5g | 1984.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
6-methoxyquinoline-2-carbonitrile (CAS 5467-79-8) is a chemical compound with the molecular formula C11H8N2O and a molecular weight of 184.19 g/mol. IUPAC name: 6-methoxyquinoline-2-carbonitrile. InChIKey: MOBUAKGGKVGTIE-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | 6-methoxyquinoline-2-carbonitrile |
| InChIKey | MOBUAKGGKVGTIE-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)N=C(C=C2)C#N |
Computed by PubChem (NCBI)