cas: 4771-49-7 — see every product listed under this CAS number, including other names
6-Methyl-1H-indole-3-carbaldehyde, 98% (CAS 4771-49-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F065312-1G |
| cas | 4771-49-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 143.72 Pln | |
| Fluorochem | 5g | 409.25 Pln | |
| Fluorochem | 10g | 726.85 Pln | |
| Fluorochem | 25g | 1726.49 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
6-methyl-1H-indole-3-carbaldehyde (CAS 4771-49-7) is a chemical compound with the molecular formula C10H9NO and a molecular weight of 159.18 g/mol. IUPAC name: 6-methyl-1H-indole-3-carbaldehyde. InChIKey: LZERQSJGPXFAKB-UHFFFAOYSA-N.
| Molecular formula | C10H9NO |
|---|---|
| Molecular weight | 159.18 g/mol |
| IUPAC name | 6-methyl-1H-indole-3-carbaldehyde |
| InChIKey | LZERQSJGPXFAKB-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=CN2)C=O |
Computed by PubChem (NCBI)