CAS 26018-42-8 appears in our catalog under these names: 6-Methyl-2,3-dihydro-1-benzofuran-2-carboxylic acid, 6-Methyl-2,3-dihydrobenzofuran-2-carboxylic acid, 98%, 98%, 6-Methyl-2,3-dihydrobenzofuran-2-carboxylic acid, 98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
6-methyl-2,3-dihydro-1-benzofuran-2-carboxylic acid (CAS 26018-42-8) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 6-methyl-2,3-dihydro-1-benzofuran-2-carboxylic acid. InChIKey: OALGDQAPRDHTMA-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | 6-methyl-2,3-dihydro-1-benzofuran-2-carboxylic acid |
| InChIKey | OALGDQAPRDHTMA-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(CC(O2)C(=O)O)C=C1 |
Computed by PubChem (NCBI)