CAS 900137-02-2 appears in our catalog under these names: 6–Methyl–4,5,6,7–tetrahydrobenzo(b)thiophene–2–carboxylic acid, 6-Methyl-4,5,6,7-tetrahydrobenzo[b]thiophene-2-carboxylic acid, 95%, 95%, 6-Methyl-4,5,6,7-tetrahydrobenzo[b]thiophene-2-carboxylic acid, 95%. Offered by: GLPBio, Chemat, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylic acid (CAS 900137-02-2) is a chemical compound with the molecular formula C10H12O2S and a molecular weight of 196.27 g/mol. IUPAC name: 6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylic acid. InChIKey: ZQTJFMHZZAFJPN-UHFFFAOYSA-N.
| Molecular formula | C10H12O2S |
|---|---|
| Molecular weight | 196.27 g/mol |
| IUPAC name | 6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylic acid |
| InChIKey | ZQTJFMHZZAFJPN-UHFFFAOYSA-N |
| SMILES | CC1CCC2=C(C1)SC(=C2)C(=O)O |
Computed by PubChem (NCBI)