CAS 202737-46-0 appears in our catalog under these names: 1-(2-Thienyl)cyclopentanecarboxylic acid, 95%, 1-(Thiophen-2-yl)cyclopentane-1-carboxylic acid, 1-(2-Thienyl)cyclopentanecarboxylic acid, 97%. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 5g, 250mg, 10g, 1g, 0,5g, 500mg.
1-thiophen-2-ylcyclopentane-1-carboxylic acid (CAS 202737-46-0) is a chemical compound with the molecular formula C10H12O2S and a molecular weight of 196.27 g/mol. IUPAC name: 1-thiophen-2-ylcyclopentane-1-carboxylic acid. InChIKey: CZCLTIDPEQAYOD-UHFFFAOYSA-N.
| Molecular formula | C10H12O2S |
|---|---|
| Molecular weight | 196.27 g/mol |
| IUPAC name | 1-thiophen-2-ylcyclopentane-1-carboxylic acid |
| InChIKey | CZCLTIDPEQAYOD-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC=CS2)C(=O)O |
Computed by PubChem (NCBI)