Products 32133-94-1

CAS 32133-94-1 is the registry number for 2-[(2,6-Dimethylphenyl)sulfanyl]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

2-(2,6-dimethylphenyl)sulfanylacetic acid (CAS 32133-94-1) is a chemical compound with the molecular formula C10H12O2S and a molecular weight of 196.27 g/mol. IUPAC name: 2-(2,6-dimethylphenyl)sulfanylacetic acid. InChIKey: XZQUGPBWUXQQBB-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12O2S
Molecular weight196.27 g/mol
IUPAC name2-(2,6-dimethylphenyl)sulfanylacetic acid
InChIKeyXZQUGPBWUXQQBB-UHFFFAOYSA-N
SMILESCC1=C(C(=CC=C1)C)SCC(=O)O

Computed by PubChem (NCBI)