CAS 32133-94-1 is the registry number for 2-[(2,6-Dimethylphenyl)sulfanyl]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.
2-(2,6-dimethylphenyl)sulfanylacetic acid (CAS 32133-94-1) is a chemical compound with the molecular formula C10H12O2S and a molecular weight of 196.27 g/mol. IUPAC name: 2-(2,6-dimethylphenyl)sulfanylacetic acid. InChIKey: XZQUGPBWUXQQBB-UHFFFAOYSA-N.
| Molecular formula | C10H12O2S |
|---|---|
| Molecular weight | 196.27 g/mol |
| IUPAC name | 2-(2,6-dimethylphenyl)sulfanylacetic acid |
| InChIKey | XZQUGPBWUXQQBB-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)SCC(=O)O |
Computed by PubChem (NCBI)