CAS 61587-90-4 is the registry number for 6-Methyl-5-nitro-1H-benzo[d]imidazole, 97%. Offered by: Ambeed. Available pack sizes: 1g.
5-methyl-6-nitro-1H-benzimidazole (CAS 61587-90-4) is a chemical compound with the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. IUPAC name: 5-methyl-6-nitro-1H-benzimidazole. InChIKey: PIIBPJWEQHHEEN-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O2 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 5-methyl-6-nitro-1H-benzimidazole |
| InChIKey | PIIBPJWEQHHEEN-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1[N+](=O)[O-])NC=N2 |
Computed by PubChem (NCBI)