6-Methylindoline-2,3-Dione, 98%, 98%
cas: 1128-47-8 — see every product listed under this CAS number, including other names
6-Methylindoline-2,3-Dione, 98%, 98% (CAS 1128-47-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114NAT-100mg |
| cas | 1128-47-8 |
| size | 100mg |
| availability | 120.84g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 170.00 Pln | |
| Chemat | 250mg | 227.60 Pln | |
| Chemat | 1g | 290.00 Pln | |
| Chemat | 5g | 578.00 Pln | |
| Chemat | 10g | 750.80 Pln | |
| Chemat | 25g | 1029.20 Pln | |
| Chemat | 50g | 1442.00 Pln | |
| Chemat | 100g | 2267.60 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6-methyl-1H-indole-2,3-dione (CAS 1128-47-8) is a chemical compound with the molecular formula C9H7NO2 and a molecular weight of 161.16 g/mol. IUPAC name: 6-methyl-1H-indole-2,3-dione. InChIKey: VFJUMJDSHGVFAH-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2 |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 6-methyl-1H-indole-2,3-dione |
| InChIKey | VFJUMJDSHGVFAH-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=O)C(=O)N2 |
Computed by PubChem (NCBI)
Synonyms:
6-methyl-1H-indole-2,3-dione, 6-Methylisatin, 6-Methylindoline-2,3-dione, 1H-Indole-2,3-dione, 6-methyl-, 6-methyl isatin, 6-Methylindole-2,3-dione, 2-Hydroxy-6-methyl-3H-indol-3-one #, 6-Methyl isatinic anhydride, AldrichCPR, Ramosetron Impurity 14 ((6-Methylisatin), 5-21-11-00178 (Beilstein Handbook Reference)