6-Methylindoline-2,3-dione 97%
cas: 1128-47-8 — see every product listed under this CAS number, including other names
6-Methylindoline-2,3-dione 97% (CAS 1128-47-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A134724-100mg |
| cas | 1128-47-8 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 231.31 Pln | |
| Ambeed | 250mg | 342.56 Pln | |
| Ambeed | 1g | 453.81 Pln | |
| Ambeed | 5g | 1215.88 Pln | |
| Ambeed | 10g | 2078.06 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A134724 |
6-methyl-1H-indole-2,3-dione (CAS 1128-47-8) is a chemical compound with the molecular formula C9H7NO2 and a molecular weight of 161.16 g/mol. IUPAC name: 6-methyl-1H-indole-2,3-dione. InChIKey: VFJUMJDSHGVFAH-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2 |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 6-methyl-1H-indole-2,3-dione |
| InChIKey | VFJUMJDSHGVFAH-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=O)C(=O)N2 |
Computed by PubChem (NCBI)
Synonyms:
6-methyl-1H-indole-2,3-dione, 6-Methylisatin, 6-Methylindoline-2,3-dione, 1H-Indole-2,3-dione, 6-methyl-, 6-methyl isatin, 6-Methylindole-2,3-dione, 2-Hydroxy-6-methyl-3H-indol-3-one #, 6-Methyl isatinic anhydride, AldrichCPR, Ramosetron Impurity 14 ((6-Methylisatin), 5-21-11-00178 (Beilstein Handbook Reference)