cas: 116530-22-4 — see every product listed under this CAS number, including other names
6-Methylnaphthalen-1-amine, ≥97%, ≥97% (CAS 116530-22-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111CPB-100mg |
| cas | 116530-22-4 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 573.20 Pln | |
| Chemat | 250mg | 1000.40 Pln | |
| Chemat | 1g | 1768.40 Pln | |
| Chemat | 5g | 6885.20 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
6-methylnaphthalen-1-amine (CAS 116530-22-4) is a chemical compound with the molecular formula C11H11N and a molecular weight of 157.21 g/mol. IUPAC name: 6-methylnaphthalen-1-amine. InChIKey: JHQJTDIFWIZURA-UHFFFAOYSA-N.
| Molecular formula | C11H11N |
|---|---|
| Molecular weight | 157.21 g/mol |
| IUPAC name | 6-methylnaphthalen-1-amine |
| InChIKey | JHQJTDIFWIZURA-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=CC=C2)N |
Computed by PubChem (NCBI)