CAS 25194-67-6 appears in our catalog under these names: 6–Phenoxypyridin–3–amine, 6-Phenoxy-3-pyridinamine, 95% , 6-Phenoxypyridin-3-amine 98%, 6-Phenoxypyridin-3-amine, 98%, 6-Phenoxypyridin-3-amine, >95% (HPLC). Offered by: GLPBio, Thermo Scientific, Ambeed, Fluorochem, TRC. Available pack sizes: 1g, 10g, 25g, 5g, 100g, 100mg, 500mg, 250mg.
6-phenoxypyridin-3-amine (CAS 25194-67-6) is a chemical compound with the molecular formula C11H10N2O and a molecular weight of 186.21 g/mol. IUPAC name: 6-phenoxypyridin-3-amine. InChIKey: DETKIRMPBJPJRQ-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | 6-phenoxypyridin-3-amine |
| InChIKey | DETKIRMPBJPJRQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=NC=C(C=C2)N |
Computed by PubChem (NCBI)