6-Phenyl-3,4-dihydronaphthalen-1(2H)-one, 95%
cas: 71912-46-4 — see every product listed under this CAS number, including other names
6-Phenyl-3,4-dihydronaphthalen-1(2H)-one, 95% (CAS 71912-46-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, Chemat, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A376961-250mg |
| cas | 71912-46-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1265.94 Pln | |
| Ambeed | 1g | 3641.12 Pln | |
| Chemat | 100mg | 563.60 Pln | |
| Chemat | 250mg | 1005.20 Pln | |
| Chemat | 1g | 2882.00 Pln | |
| Fluorochem | 100mg | 1039.24 Pln | |
| Fluorochem | 250mg | 1856.66 Pln | |
| Fluorochem | 1g | 5339.80 Pln | |
| BLDpharm | 100mg | 758.65 Pln | |
| BLDpharm | 250mg | 1358.44 Pln | |
| BLDpharm | 1g | 3918.64 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
6-phenyl-3,4-dihydro-2H-naphthalen-1-one (CAS 71912-46-4) is a chemical compound with the molecular formula C16H14O and a molecular weight of 222.28 g/mol. IUPAC name: 6-phenyl-3,4-dihydro-2H-naphthalen-1-one. InChIKey: YTMCAZRLLQPOBL-UHFFFAOYSA-N.
| Molecular formula | C16H14O |
|---|---|
| Molecular weight | 222.28 g/mol |
| IUPAC name | 6-phenyl-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | YTMCAZRLLQPOBL-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)C3=CC=CC=C3)C(=O)C1 |
Computed by PubChem (NCBI)