Products 22371-34-2

CAS 22371-34-2 is the registry number for rac-1-Anthracen-2-yl-ethanol. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 25mg, 50mg, 500mg, 250mg, 1000mg.

Structural formula: {0} (CAS {1})

1-anthracen-2-ylethanol (CAS 22371-34-2) is a chemical compound with the molecular formula C16H14O and a molecular weight of 222.28 g/mol. IUPAC name: 1-anthracen-2-ylethanol. InChIKey: YVHJEBTVAVRWIP-UHFFFAOYSA-N.

Identity
Molecular formulaC16H14O
Molecular weight222.28 g/mol
IUPAC name1-anthracen-2-ylethanol
InChIKeyYVHJEBTVAVRWIP-UHFFFAOYSA-N
SMILESCC(C1=CC2=CC3=CC=CC=C3C=C2C=C1)O

Computed by PubChem (NCBI)