CAS 1260161-41-8 is the registry number for 3-([1,1'-Biphenyl]-4-yl)cyclobutan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4-phenylphenyl)cyclobutan-1-one (CAS 1260161-41-8) is a chemical compound with the molecular formula C16H14O and a molecular weight of 222.28 g/mol. IUPAC name: 3-(4-phenylphenyl)cyclobutan-1-one. InChIKey: KVQTYQHZRDZTFG-UHFFFAOYSA-N.
| Molecular formula | C16H14O |
|---|---|
| Molecular weight | 222.28 g/mol |
| IUPAC name | 3-(4-phenylphenyl)cyclobutan-1-one |
| InChIKey | KVQTYQHZRDZTFG-UHFFFAOYSA-N |
| SMILES | C1C(CC1=O)C2=CC=C(C=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)