CAS 73458-38-5 appears in our catalog under these names: 6-Phenylbenzo[d]thiazol-2-amine, 95%, 95%, 6-Phenylbenzo[d]thiazol-2-amine. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
6-phenyl-1,3-benzothiazol-2-amine (CAS 73458-38-5) is a chemical compound with the molecular formula C13H10N2S and a molecular weight of 226.30 g/mol. IUPAC name: 6-phenyl-1,3-benzothiazol-2-amine. InChIKey: GIOCFNWQTZDWNE-UHFFFAOYSA-N.
| Molecular formula | C13H10N2S |
|---|---|
| Molecular weight | 226.30 g/mol |
| IUPAC name | 6-phenyl-1,3-benzothiazol-2-amine |
| InChIKey | GIOCFNWQTZDWNE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=C(C=C2)N=C(S3)N |
Computed by PubChem (NCBI)