CAS 1843-21-6 appears in our catalog under these names: N–Phenylbenzo(d)thiazol–2–amine, N-Phenyl-1,3-benzothiazol-2-amine, N-Phenylbenzo[d]thiazol-2-amine 95%, N-Phenylbenzo[d]thiazol-2-amine, 95%, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 100mg, 2,5g, 250mg, 1g, 5g.
N-phenyl-1,3-benzothiazol-2-amine (CAS 1843-21-6) is a chemical compound with the molecular formula C13H10N2S and a molecular weight of 226.30 g/mol. IUPAC name: N-phenyl-1,3-benzothiazol-2-amine. InChIKey: QDTDFSFRIDFTCF-UHFFFAOYSA-N.
| Molecular formula | C13H10N2S |
|---|---|
| Molecular weight | 226.30 g/mol |
| IUPAC name | N-phenyl-1,3-benzothiazol-2-amine |
| InChIKey | QDTDFSFRIDFTCF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=NC3=CC=CC=C3S2 |
Computed by PubChem (NCBI)