CAS 21418-32-6 appears in our catalog under these names: 4-Phenyl-1,3-benzothiazol-2-amine, 95%, 4-PHenyl-1,3-benzothiazol-2-amine 95%, 4-PHenyl-1,3-benzothiazol-2-amine, 95%, 95%, 4-Phenylbenzo[d]thiazol-2-amine, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
4-phenyl-1,3-benzothiazol-2-amine (CAS 21418-32-6) is a chemical compound with the molecular formula C13H10N2S and a molecular weight of 226.30 g/mol. IUPAC name: 4-phenyl-1,3-benzothiazol-2-amine. InChIKey: SIVSDUVSMURHKT-UHFFFAOYSA-N.
| Molecular formula | C13H10N2S |
|---|---|
| Molecular weight | 226.30 g/mol |
| IUPAC name | 4-phenyl-1,3-benzothiazol-2-amine |
| InChIKey | SIVSDUVSMURHKT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C3C(=CC=C2)SC(=N3)N |
Computed by PubChem (NCBI)