cas: 845306-05-0 — see every product listed under this CAS number, including other names
6-chloro-N,N-dimethyl-2-pyridinecarboxamide, 96% (CAS 845306-05-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F312424-250MG |
| cas | 845306-05-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 393.63 Pln | |
| Fluorochem | 1g | 940.31 Pln | |
| Fluorochem | 5g | 2746.97 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
6-chloro-N,N-dimethylpyridine-2-carboxamide (CAS 845306-05-0) is a chemical compound with the molecular formula C8H9ClN2O and a molecular weight of 184.62 g/mol. IUPAC name: 6-chloro-N,N-dimethylpyridine-2-carboxamide. InChIKey: CNCWTWVWSPMBLK-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O |
|---|---|
| Molecular weight | 184.62 g/mol |
| IUPAC name | 6-chloro-N,N-dimethylpyridine-2-carboxamide |
| InChIKey | CNCWTWVWSPMBLK-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=NC(=CC=C1)Cl |
Computed by PubChem (NCBI)