cas: 1242268-17-2 — see every product listed under this CAS number, including other names
6-tert-Butyl 1-ethyl 6-azaspiro[2.5]octane-1,6-dicarboxylate 95% (CAS 1242268-17-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A805915-100mg |
| cas | 1242268-17-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 209.06 Pln | |
| Ambeed | 250mg | 342.56 Pln | |
| Ambeed | 1g | 1010.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A805915 |
6-O-tert-butyl 2-O-ethyl 6-azaspiro[2.5]octane-2,6-dicarboxylate (CAS 1242268-17-2) is a chemical compound with the molecular formula C15H25NO4 and a molecular weight of 283.36 g/mol. IUPAC name: 6-O-tert-butyl 2-O-ethyl 6-azaspiro[2.5]octane-2,6-dicarboxylate. InChIKey: MWXOEHQQUHBXTN-UHFFFAOYSA-N.
| Molecular formula | C15H25NO4 |
|---|---|
| Molecular weight | 283.36 g/mol |
| IUPAC name | 6-O-tert-butyl 2-O-ethyl 6-azaspiro[2.5]octane-2,6-dicarboxylate |
| InChIKey | MWXOEHQQUHBXTN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CC12CCN(CC2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)