cas: 1395493-25-0 — see every product listed under this CAS number, including other names
6H-Pyrrolo[3,4-c]pyridazine-6-carboxylic acid, 2,3,5,7-tetrahydro-3-oxo-, 1,1-dimethylethyl ester, 95%, 95% (CAS 1395493-25-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112B9Q-100mg |
| cas | 1395493-25-0 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 472.40 Pln | |
| Chemat | 250mg | 688.40 Pln | |
| Chemat | 1g | 1682.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-oxo-5,7-dihydro-2H-pyrrolo[3,4-c]pyridazine-6-carboxylate (CAS 1395493-25-0) is a chemical compound with the molecular formula C11H15N3O3 and a molecular weight of 237.25 g/mol. IUPAC name: tert-butyl 3-oxo-5,7-dihydro-2H-pyrrolo[3,4-c]pyridazine-6-carboxylate. InChIKey: MLTOJIPVKVSXEM-UHFFFAOYSA-N.
| Molecular formula | C11H15N3O3 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | tert-butyl 3-oxo-5,7-dihydro-2H-pyrrolo[3,4-c]pyridazine-6-carboxylate |
| InChIKey | MLTOJIPVKVSXEM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=CC(=O)NN=C2C1 |
Computed by PubChem (NCBI)