cas: 318685-41-5 — see every product listed under this CAS number, including other names
7,8-Difluoroquinoline-3-carboxylic acid, 95%, 95% (CAS 318685-41-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CMNQ-100mg |
| cas | 318685-41-5 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 434.00 Pln | |
| Chemat | 1g | 1005.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
7,8-difluoroquinoline-3-carboxylic acid (CAS 318685-41-5) is a chemical compound with the molecular formula C10H5F2NO2 and a molecular weight of 209.15 g/mol. IUPAC name: 7,8-difluoroquinoline-3-carboxylic acid. InChIKey: AMKQPUGRVXSJNI-UHFFFAOYSA-N.
| Molecular formula | C10H5F2NO2 |
|---|---|
| Molecular weight | 209.15 g/mol |
| IUPAC name | 7,8-difluoroquinoline-3-carboxylic acid |
| InChIKey | AMKQPUGRVXSJNI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=NC=C(C=C21)C(=O)O)F)F |
Computed by PubChem (NCBI)