7,8-Difluoroquinoline-3-carboxylic acid, 95%
cas: 318685-41-5 — see every product listed under this CAS number, including other names
7,8-Difluoroquinoline-3-carboxylic acid, 95% (CAS 318685-41-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg. Offered by: Combi-blocks, Ambeed, Chemat, BLDpharm.
| brand | Combi-blocks |
|---|---|
| catalog number | QJ-6143-250mg |
| cas | 318685-41-5 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 100mg | price on request | |
| Ambeed | 100mg | 359.25 Pln | |
| Ambeed | 250mg | 592.88 Pln | |
| Ambeed | 1g | 1076.81 Pln | |
| Ambeed | 5g | 4175.12 Pln | |
| Chemat | 100mg | 338.00 Pln | |
| Chemat | 250mg | 558.80 Pln | |
| Chemat | 1g | 1312.40 Pln | |
| Chemat | 5g | 3813.20 Pln | |
| BLDpharm | 100mg | 392.11 Pln | |
| BLDpharm | 250mg | 642.02 Pln | |
| BLDpharm | 1g | 1152.95 Pln | |
| BLDpharm | 5g | 4496.22 Pln | |
| Fluorochem | 100mg | 612.30 Pln | |
| Fluorochem | 250mg | 1023.62 Pln | |
| Fluorochem | 1g | 2434.58 Pln | |
| Fluorochem | 5g | 6943.41 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
7,8-difluoroquinoline-3-carboxylic acid (CAS 318685-41-5) is a chemical compound with the molecular formula C10H5F2NO2 and a molecular weight of 209.15 g/mol. IUPAC name: 7,8-difluoroquinoline-3-carboxylic acid. InChIKey: AMKQPUGRVXSJNI-UHFFFAOYSA-N.
| Molecular formula | C10H5F2NO2 |
|---|---|
| Molecular weight | 209.15 g/mol |
| IUPAC name | 7,8-difluoroquinoline-3-carboxylic acid |
| InChIKey | AMKQPUGRVXSJNI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=NC=C(C=C21)C(=O)O)F)F |
Computed by PubChem (NCBI)