Products 953905-51-6

CAS 953905-51-6 is the registry number for 2-Cyano-3-(2,4-difluorophenyl)-2-propenoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

(E)-2-cyano-3-(2,4-difluorophenyl)prop-2-enoic acid (CAS 953905-51-6) is a chemical compound with the molecular formula C10H5F2NO2 and a molecular weight of 209.15 g/mol. IUPAC name: (E)-2-cyano-3-(2,4-difluorophenyl)prop-2-enoic acid. InChIKey: UQLFCBBYHQBVQY-XVNBXDOJSA-N.

Identity
Molecular formulaC10H5F2NO2
Molecular weight209.15 g/mol
IUPAC name(E)-2-cyano-3-(2,4-difluorophenyl)prop-2-enoic acid
InChIKeyUQLFCBBYHQBVQY-XVNBXDOJSA-N
SMILESC1=CC(=C(C=C1F)F)/C=C(\C#N)/C(=O)O

Computed by PubChem (NCBI)