CAS 953905-51-6 is the registry number for 2-Cyano-3-(2,4-difluorophenyl)-2-propenoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.
(E)-2-cyano-3-(2,4-difluorophenyl)prop-2-enoic acid (CAS 953905-51-6) is a chemical compound with the molecular formula C10H5F2NO2 and a molecular weight of 209.15 g/mol. IUPAC name: (E)-2-cyano-3-(2,4-difluorophenyl)prop-2-enoic acid. InChIKey: UQLFCBBYHQBVQY-XVNBXDOJSA-N.
| Molecular formula | C10H5F2NO2 |
|---|---|
| Molecular weight | 209.15 g/mol |
| IUPAC name | (E)-2-cyano-3-(2,4-difluorophenyl)prop-2-enoic acid |
| InChIKey | UQLFCBBYHQBVQY-XVNBXDOJSA-N |
| SMILES | C1=CC(=C(C=C1F)F)/C=C(\C#N)/C(=O)O |
Computed by PubChem (NCBI)