cas: 934586-50-2 — see every product listed under this CAS number, including other names
7-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydrobenzo[b]furan, 95% (CAS 934586-50-2) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | CC00939CB |
| cas | 934586-50-2 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 436.79 Pln | |
| Thermo Scientific | 1g | 1130.16 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 95% |
2-(2,3-dihydro-1-benzofuran-7-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 934586-50-2) is a chemical compound with the molecular formula C14H19BO3 and a molecular weight of 246.11 g/mol. IUPAC name: 2-(2,3-dihydro-1-benzofuran-7-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: HCAAUTYLSSDHFV-UHFFFAOYSA-N.
| Molecular formula | C14H19BO3 |
|---|---|
| Molecular weight | 246.11 g/mol |
| IUPAC name | 2-(2,3-dihydro-1-benzofuran-7-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | HCAAUTYLSSDHFV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C(=CC=C2)CCO3 |
Computed by PubChem (NCBI)