cas: 190788-61-5 — see every product listed under this CAS number, including other names
7-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-chromen-2-one, 95%, 95% (CAS 190788-61-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113ESX-100mg |
| cas | 190788-61-5 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 371.60 Pln | |
| Chemat | 250mg | 554.00 Pln | |
| Chemat | 1g | 1533.20 Pln | |
| Chemat | 5g | 4965.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)chromen-2-one (CAS 190788-61-5) is a chemical compound with the molecular formula C15H17BO4 and a molecular weight of 272.11 g/mol. IUPAC name: 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)chromen-2-one. InChIKey: BSNRAQZLNMHAOJ-UHFFFAOYSA-N.
| Molecular formula | C15H17BO4 |
|---|---|
| Molecular weight | 272.11 g/mol |
| IUPAC name | 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)chromen-2-one |
| InChIKey | BSNRAQZLNMHAOJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)C=CC(=O)O3 |
Computed by PubChem (NCBI)