cas: 190788-61-5 — see every product listed under this CAS number, including other names
7-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-chromen-2-one (CAS 190788-61-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F614762-100MG |
| cas | 190788-61-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 591.48 Pln | |
| Fluorochem | 250mg | 888.25 Pln | |
| Fluorochem | 1g | 2512.67 Pln | |
| Fluorochem | 5g | 8198.17 Pln |
| delivery time | 3-4 weeks |
|---|
7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)chromen-2-one (CAS 190788-61-5) is a chemical compound with the molecular formula C15H17BO4 and a molecular weight of 272.11 g/mol. IUPAC name: 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)chromen-2-one. InChIKey: BSNRAQZLNMHAOJ-UHFFFAOYSA-N.
| Molecular formula | C15H17BO4 |
|---|---|
| Molecular weight | 272.11 g/mol |
| IUPAC name | 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)chromen-2-one |
| InChIKey | BSNRAQZLNMHAOJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)C=CC(=O)O3 |
Computed by PubChem (NCBI)