CAS 1150114-57-0 is the registry number for 6-Hydroxy-5-(tetrahydropyran-2-yl)naphthalene-2-boronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[6-hydroxy-5-(oxan-2-yl)naphthalen-2-yl]boronic acid (CAS 1150114-57-0) is a chemical compound with the molecular formula C15H17BO4 and a molecular weight of 272.11 g/mol. IUPAC name: [6-hydroxy-5-(oxan-2-yl)naphthalen-2-yl]boronic acid. InChIKey: KQWMQSDRQNNXEN-UHFFFAOYSA-N.
| Molecular formula | C15H17BO4 |
|---|---|
| Molecular weight | 272.11 g/mol |
| IUPAC name | [6-hydroxy-5-(oxan-2-yl)naphthalen-2-yl]boronic acid |
| InChIKey | KQWMQSDRQNNXEN-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C(=C(C=C2)O)C3CCCCO3)(O)O |
Computed by PubChem (NCBI)