Products 2589531-78-0
CAS 2589531-78-0 appears in our catalog under these names: 7-(Chloromethyl)-3-ethyl-1,5-naphthyridin-2(1H)-one, 98%, 98%, 7-(Chloromethyl)-3-ethyl-1,5-naphthyridin-2(1H)-one, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 500mg, 1g.
7-(chloromethyl)-3-ethyl-1H-1,5-naphthyridin-2-one (CAS 2589531-78-0) is a chemical compound with the molecular formula C11H11ClN2O and a molecular weight of 222.67 g/mol. IUPAC name: 7-(chloromethyl)-3-ethyl-1H-1,5-naphthyridin-2-one. InChIKey: WSBPQZJLXUGIBP-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2O |
|---|---|
| Molecular weight | 222.67 g/mol |
| IUPAC name | 7-(chloromethyl)-3-ethyl-1H-1,5-naphthyridin-2-one |
| InChIKey | WSBPQZJLXUGIBP-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=C(C=C(C=N2)CCl)NC1=O |
Computed by PubChem (NCBI)