CAS 568555-62-4 is the registry number for 2-(2-Chloro-benzyl)-5-methyl-2,4-dihydro-pyrazol-3-one, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
2-[(2-chlorophenyl)methyl]-5-methyl-4H-pyrazol-3-one (CAS 568555-62-4) is a chemical compound with the molecular formula C11H11ClN2O and a molecular weight of 222.67 g/mol. IUPAC name: 2-[(2-chlorophenyl)methyl]-5-methyl-4H-pyrazol-3-one. InChIKey: BKIIPXRIUNXZCC-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2O |
|---|---|
| Molecular weight | 222.67 g/mol |
| IUPAC name | 2-[(2-chlorophenyl)methyl]-5-methyl-4H-pyrazol-3-one |
| InChIKey | BKIIPXRIUNXZCC-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=O)C1)CC2=CC=CC=C2Cl |
Computed by PubChem (NCBI)