CAS 1283077-06-4 appears in our catalog under these names: (3Z)-6-Chloro-3-[(dimethylamino)methylene]-1,3-dihydro-2h-indol-2-one, 95%, (Z)-6-Chloro-3-((dimethylamino)methylene)indolin-2-one, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
(3Z)-6-chloro-3-(dimethylaminomethylidene)-1H-indol-2-one (CAS 1283077-06-4) is a chemical compound with the molecular formula C11H11ClN2O and a molecular weight of 222.67 g/mol. IUPAC name: (3Z)-6-chloro-3-(dimethylaminomethylidene)-1H-indol-2-one. InChIKey: YJDOALCKVFVBTA-TWGQIWQCSA-N.
| Molecular formula | C11H11ClN2O |
|---|---|
| Molecular weight | 222.67 g/mol |
| IUPAC name | (3Z)-6-chloro-3-(dimethylaminomethylidene)-1H-indol-2-one |
| InChIKey | YJDOALCKVFVBTA-TWGQIWQCSA-N |
| SMILES | CN(C)/C=C\1/C2=C(C=C(C=C2)Cl)NC1=O |
Computed by PubChem (NCBI)