cas: 704208-25-3 — see every product listed under this CAS number, including other names
7-(Trifluoromethyl)chroman-4-amine, 95%, 95% (CAS 704208-25-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116UP6-1g |
| cas | 704208-25-3 |
| size | 1g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1653.20 Pln | |
| Chemat | 5g | 4821.20 Pln | |
| Chemat | 10g | 7984.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
7-(trifluoromethyl)-3,4-dihydro-2H-chromen-4-amine (CAS 704208-25-3) is a chemical compound with the molecular formula C10H10F3NO and a molecular weight of 217.19 g/mol. IUPAC name: 7-(trifluoromethyl)-3,4-dihydro-2H-chromen-4-amine. InChIKey: MMCIPVIZAJIRKM-UHFFFAOYSA-N.
| Molecular formula | C10H10F3NO |
|---|---|
| Molecular weight | 217.19 g/mol |
| IUPAC name | 7-(trifluoromethyl)-3,4-dihydro-2H-chromen-4-amine |
| InChIKey | MMCIPVIZAJIRKM-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1N)C=CC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)