cas: 704208-25-3 — see every product listed under this CAS number, including other names
7-(Trifluoromethyl)chroman-4-amine, 97% (CAS 704208-25-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F216882-100MG |
| cas | 704208-25-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 164.54 Pln | |
| Fluorochem | 250mg | 320.74 Pln | |
| Fluorochem | 1g | 1044.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
7-(trifluoromethyl)-3,4-dihydro-2H-chromen-4-amine (CAS 704208-25-3) is a chemical compound with the molecular formula C10H10F3NO and a molecular weight of 217.19 g/mol. IUPAC name: 7-(trifluoromethyl)-3,4-dihydro-2H-chromen-4-amine. InChIKey: MMCIPVIZAJIRKM-UHFFFAOYSA-N.
| Molecular formula | C10H10F3NO |
|---|---|
| Molecular weight | 217.19 g/mol |
| IUPAC name | 7-(trifluoromethyl)-3,4-dihydro-2H-chromen-4-amine |
| InChIKey | MMCIPVIZAJIRKM-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1N)C=CC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)