cas: 480436-44-0 — see every product listed under this CAS number, including other names
7-(tert-Butyl)-1H-indole, 97%, 97% (CAS 480436-44-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12K1P6-100mg |
| cas | 480436-44-0 |
| size | 100mg |
| availability | 0.3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 362.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
7-tert-butyl-1H-indole (CAS 480436-44-0) is a chemical compound with the molecular formula C12H15N and a molecular weight of 173.25 g/mol. IUPAC name: 7-tert-butyl-1H-indole. InChIKey: NZZQQDKASZDKJQ-UHFFFAOYSA-N.
| Molecular formula | C12H15N |
|---|---|
| Molecular weight | 173.25 g/mol |
| IUPAC name | 7-tert-butyl-1H-indole |
| InChIKey | NZZQQDKASZDKJQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=CC2=C1NC=C2 |
Computed by PubChem (NCBI)