cas: 1588498-37-6 — see every product listed under this CAS number, including other names
7-(tert-Butyl)-2,5-dimethyl-3,4-dihydro-2H-pyrano[2,3-b]quinoline, 97%, 97% (CAS 1588498-37-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch135H3Z-250mg |
| cas | 1588498-37-6 |
| size | 250mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 290.00 Pln | |
| Chemat | 1g | 678.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
7-tert-butyl-2,5-dimethyl-3,4-dihydro-2H-pyrano[2,3-b]quinoline (CAS 1588498-37-6) is a chemical compound with the molecular formula C18H23NO and a molecular weight of 269.4 g/mol. IUPAC name: 7-tert-butyl-2,5-dimethyl-3,4-dihydro-2H-pyrano[2,3-b]quinoline. InChIKey: HGKGTNXPFXRVQB-UHFFFAOYSA-N.
| Molecular formula | C18H23NO |
|---|---|
| Molecular weight | 269.4 g/mol |
| IUPAC name | 7-tert-butyl-2,5-dimethyl-3,4-dihydro-2H-pyrano[2,3-b]quinoline |
| InChIKey | HGKGTNXPFXRVQB-UHFFFAOYSA-N |
| SMILES | CC1CCC2=C(O1)N=C3C=CC(=CC3=C2C)C(C)(C)C |
Computed by PubChem (NCBI)