CAS 1459-50-3 appears in our catalog under these names: N-[4-(1-Adamantyl)phenyl]acetamide, 95%, N–(4–(Adamantan–1–yl)phenyl)acetamide, N-(4-(Adamantan-1-yl)phenyl)acetamide, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 10g, 1g, 100mg, 2.5g.
N-[4-(1-adamantyl)phenyl]acetamide (CAS 1459-50-3) is a chemical compound with the molecular formula C18H23NO and a molecular weight of 269.4 g/mol. IUPAC name: N-[4-(1-adamantyl)phenyl]acetamide. InChIKey: ZVJQMQNYDNEXKB-UHFFFAOYSA-N.
| Molecular formula | C18H23NO |
|---|---|
| Molecular weight | 269.4 g/mol |
| IUPAC name | N-[4-(1-adamantyl)phenyl]acetamide |
| InChIKey | ZVJQMQNYDNEXKB-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)C23CC4CC(C2)CC(C4)C3 |
Computed by PubChem (NCBI)