CAS 144054-70-6 appears in our catalog under these names: (S)-(-)-2-Amino-3,3-dimethyl-1,1-diphenyl-1-butanol, 95%, (S)-(-)-2-Amino-3,3-dimethyl-1,1-diphenyl-1-butanol, >98.0%(HPLC), (S)-(-)-2-Amino-3,3-dimethyl-1,1-diphenyl-1-butanol, ≥98%, ≥98%, (S)-2-amino-3,3-dimethyl-1,1-diphenylbutan-1-ol. Offered by: Combi-blocks, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 50mg, 250mg, 25g, 100g.
(2S)-2-amino-3,3-dimethyl-1,1-diphenylbutan-1-ol (CAS 144054-70-6) is a chemical compound with the molecular formula C18H23NO and a molecular weight of 269.4 g/mol. IUPAC name: (2S)-2-amino-3,3-dimethyl-1,1-diphenylbutan-1-ol. InChIKey: HZIHDWNOPKIOCK-INIZCTEOSA-N.
| Molecular formula | C18H23NO |
|---|---|
| Molecular weight | 269.4 g/mol |
| IUPAC name | (2S)-2-amino-3,3-dimethyl-1,1-diphenylbutan-1-ol |
| InChIKey | HZIHDWNOPKIOCK-INIZCTEOSA-N |
| SMILES | CC(C)(C)[C@@H](C(C1=CC=CC=C1)(C2=CC=CC=C2)O)N |
Computed by PubChem (NCBI)