7-(tert-Butyl)-2,5-dimethyl-3,4-dihydro-2H-pyrano[2,3-b]quinoline, 97%
cas: 1588498-37-6 — see every product listed under this CAS number, including other names
7-(tert-Butyl)-2,5-dimethyl-3,4-dihydro-2H-pyrano[2,3-b]quinoline, 97% (CAS 1588498-37-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1339676-250mg |
| cas | 1588498-37-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 309.19 Pln | |
| Ambeed | 1g | 726.38 Pln | |
| Ambeed | 5g | 2439.62 Pln | |
| BLDpharm | 250mg | 325.47 Pln | |
| BLDpharm | 1g | 775.31 Pln | |
| BLDpharm | 5g | 2430.28 Pln | |
| Chemat | 250mg | 366.80 Pln | |
| Chemat | 1g | 885.20 Pln | |
| Fluorochem | 250mg | 664.37 Pln | |
| Fluorochem | 1g | 1643.19 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
7-tert-butyl-2,5-dimethyl-3,4-dihydro-2H-pyrano[2,3-b]quinoline (CAS 1588498-37-6) is a chemical compound with the molecular formula C18H23NO and a molecular weight of 269.4 g/mol. IUPAC name: 7-tert-butyl-2,5-dimethyl-3,4-dihydro-2H-pyrano[2,3-b]quinoline. InChIKey: HGKGTNXPFXRVQB-UHFFFAOYSA-N.
| Molecular formula | C18H23NO |
|---|---|
| Molecular weight | 269.4 g/mol |
| IUPAC name | 7-tert-butyl-2,5-dimethyl-3,4-dihydro-2H-pyrano[2,3-b]quinoline |
| InChIKey | HGKGTNXPFXRVQB-UHFFFAOYSA-N |
| SMILES | CC1CCC2=C(O1)N=C3C=CC(=CC3=C2C)C(C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
7-(tert-Butyl)-2,5-dimethyl-3,4-dihydro-2H-pyrano[2,3-b]quinoline, 7-tert-butyl-2,5-dimethyl-3,4-dihydro-2H-pyrano[2,3-b]quinoline, Li-Yu t-Butyl Quinoline, 95%, 2H-Pyrano[2,3-b]quinoline, 7-(1,1-dimethylethyl)-3,4-dihydro-2,5-dimethyl-, 7-(1,1-Dimethylethyl)-3,4-dihydro-2,5-dimethyl-2H-pyrano[2,3-b]quinoline